C12H21Cl3N2O — CID 131844775
4-chloro-2,6-bis[(dimethylamino)methyl]phenol;dihydrochloride (PubChem CID 131844775) has the molecular formula C12H21Cl3N2O and a molecular weight of 315.67 g/mol. Its IUPAC name is 4-chloro-2,6-bis[(dimethylamino)methyl]phenol;dihydrochloride.
| Compound Name | 4-chloro-2,6-bis[(dimethylamino)methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 131844775 |
| Molecular Formula | C12H21Cl3N2O |
| Molecular Weight | 315.67 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-chloro-2,6-bis[(dimethylamino)methyl]phenol;dihydrochloride |
| SMILES | CN(C)Cc1cc(Cl)cc(CN(C)C)c1O.Cl.Cl |
| InChI | InChI=1S/C12H19ClN2O.2ClH/c1-14(2)7-9-5-11(13)6-10(12(9)16)8-15(3)4;;/h5-6,16H,7-8H2,1-4H3;2*1H |
| InChIKey | CWFUTZOMFRBHKM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|