C9H15N3O — CID 123247058
2,4-diamino-6-[(dimethylamino)methyl]phenol (PubChem CID 123247058) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2,4-diamino-6-[(dimethylamino)methyl]phenol.
| Compound Name | 2,4-diamino-6-[(dimethylamino)methyl]phenol |
|---|---|
| PubChem CID | 123247058 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2,4-diamino-6-[(dimethylamino)methyl]phenol |
| SMILES | CN(C)Cc1cc(N)cc(N)c1O |
| InChI | InChI=1S/C9H15N3O/c1-12(2)5-6-3-7(10)4-8(11)9(6)13/h3-4,13H,5,10-11H2,1-2H3 |
| InChIKey | JIXTXQOSTWHNSY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|