C13H18Cl2N2O2 — CID 82978834
2-[(3,5-dichloro-2-hydroxyphenyl)methyl-(2-methylpropyl)amino]acetamide (PubChem CID 82978834) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-hydroxyphenyl)methyl-(2-methylpropyl)amino]acetamide.
| Compound Name | 2-[(3,5-dichloro-2-hydroxyphenyl)methyl-(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 82978834 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-[(3,5-dichloro-2-hydroxyphenyl)methyl-(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CN(CC(N)=O)Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-8(2)5-17(7-12(16)18)6-9-3-10(14)4-11(15)13(9)19/h3-4,8,19H,5-7H2,1-2H3,(H2,16,18) |
| InChIKey | NNNZTAZUMIVIHZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|