C13H19BrN2O2 — CID 82978692
2-[(3-bromo-2-hydroxyphenyl)methyl-(2-methylpropyl)amino]acetamide (PubChem CID 82978692) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-[(3-bromo-2-hydroxyphenyl)methyl-(2-methylpropyl)amino]acetamide.
| Compound Name | 2-[(3-bromo-2-hydroxyphenyl)methyl-(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 82978692 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[(3-bromo-2-hydroxyphenyl)methyl-(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CN(CC(N)=O)Cc1cccc(Br)c1O |
| InChI | InChI=1S/C13H19BrN2O2/c1-9(2)6-16(8-12(15)17)7-10-4-3-5-11(14)13(10)18/h3-5,9,18H,6-8H2,1-2H3,(H2,15,17) |
| InChIKey | NXIBAICZZWJTLX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|