C9H9Cl2F5N2 — CID 171311959
2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-chloroaniline;hydrochloride (PubChem CID 171311959) has the molecular formula C9H9Cl2F5N2 and a molecular weight of 311.08 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-chloroaniline;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-chloroaniline;hydrochloride |
|---|---|
| PubChem CID | 171311959 |
| Molecular Formula | C9H9Cl2F5N2 |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-chloroaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(Cl)cc1[C@H](N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8ClF5N2.ClH/c10-4-1-2-6(16)5(3-4)7(17)8(11,12)9(13,14)15;/h1-3,7H,16-17H2;1H/t7-;/m0./s1 |
| InChIKey | UJKSNYRKZZEURV-FJXQXJEOSA-N |
| XLogP | 3.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|