C19H13Cl3FNO — CID 88990967
4-[(4-chlorophenyl)-(2,4-dichlorophenyl)methoxy]-3-fluoroaniline (PubChem CID 88990967) has the molecular formula C19H13Cl3FNO and a molecular weight of 396.68 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-(2,4-dichlorophenyl)methoxy]-3-fluoroaniline.
| Compound Name | 4-[(4-chlorophenyl)-(2,4-dichlorophenyl)methoxy]-3-fluoroaniline |
|---|---|
| PubChem CID | 88990967 |
| Molecular Formula | C19H13Cl3FNO |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 4-[(4-chlorophenyl)-(2,4-dichlorophenyl)methoxy]-3-fluoroaniline |
| SMILES | Nc1ccc(OC(c2ccc(Cl)cc2)c2ccc(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C19H13Cl3FNO/c20-12-3-1-11(2-4-12)19(15-7-5-13(21)9-16(15)22)25-18-8-6-14(24)10-17(18)23/h1-10,19H,24H2 |
| InChIKey | GDHFOPKTUFEDNR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|