C19H17Cl2NO2 — CID 20501966
ethyl 4-cyano-4-(2,4-dichlorophenyl)-3-phenylbutanoate (PubChem CID 20501966) has the molecular formula C19H17Cl2NO2 and a molecular weight of 362.26 g/mol. Its IUPAC name is ethyl 4-cyano-4-(2,4-dichlorophenyl)-3-phenylbutanoate.
| Compound Name | ethyl 4-cyano-4-(2,4-dichlorophenyl)-3-phenylbutanoate |
|---|---|
| PubChem CID | 20501966 |
| Molecular Formula | C19H17Cl2NO2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | ethyl 4-cyano-4-(2,4-dichlorophenyl)-3-phenylbutanoate |
| SMILES | CCOC(=O)CC(c1ccccc1)C(C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2NO2/c1-2-24-19(23)11-16(13-6-4-3-5-7-13)17(12-22)15-9-8-14(20)10-18(15)21/h3-10,16-17H,2,11H2,1H3 |
| InChIKey | QKNHXFQIJYMLFK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |