C18H14Cl2IN — CID 44888619
1-[(2,4-dichlorophenyl)-phenylmethyl]pyridin-1-ium iodide (PubChem CID 44888619) has the molecular formula C18H14Cl2IN and a molecular weight of 442.13 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)-phenylmethyl]pyridin-1-ium iodide.
| Compound Name | 1-[(2,4-dichlorophenyl)-phenylmethyl]pyridin-1-ium iodide |
|---|---|
| PubChem CID | 44888619 |
| Molecular Formula | C18H14Cl2IN |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 440.95 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)-phenylmethyl]pyridin-1-ium iodide |
| SMILES | Clc1ccc(C(c2ccccc2)[n+]2ccccc2)c(Cl)c1.[I-] |
| InChI | InChI=1S/C18H14Cl2N.HI/c19-15-9-10-16(17(20)13-15)18(14-7-3-1-4-8-14)21-11-5-2-6-12-21;/h1-13,18H;1H/q+1;/p-1 |
| InChIKey | BGOQFYUDAWNSBH-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|