C8H8Cl3NO3 — CID 67868356
2-aminooxy-2-(2,4-dichlorophenyl)acetic acid;hydrochloride (PubChem CID 67868356) has the molecular formula C8H8Cl3NO3 and a molecular weight of 272.52 g/mol. Its IUPAC name is 2-aminooxy-2-(2,4-dichlorophenyl)acetic acid;hydrochloride.
| Compound Name | 2-aminooxy-2-(2,4-dichlorophenyl)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 67868356 |
| Molecular Formula | C8H8Cl3NO3 |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 2-aminooxy-2-(2,4-dichlorophenyl)acetic acid;hydrochloride |
| SMILES | Cl.NOC(C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl2NO3.ClH/c9-4-1-2-5(6(10)3-4)7(14-11)8(12)13;/h1-3,7H,11H2,(H,12,13);1H |
| InChIKey | REMJVGARRXSRTH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|