C15H14Cl2 — CID 54387029
2,4-dichloro-1-(2-propan-2-ylphenyl)benzene (PubChem CID 54387029) has the molecular formula C15H14Cl2 and a molecular weight of 265.18 g/mol. Its IUPAC name is 2,4-dichloro-1-(2-propan-2-ylphenyl)benzene.
| Compound Name | 2,4-dichloro-1-(2-propan-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 54387029 |
| Molecular Formula | C15H14Cl2 |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2,4-dichloro-1-(2-propan-2-ylphenyl)benzene |
| SMILES | CC(C)c1ccccc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2/c1-10(2)12-5-3-4-6-13(12)14-8-7-11(16)9-15(14)17/h3-10H,1-2H3 |
| InChIKey | AEPNYSPVTCHESO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |