C12H11Cl2NO — CID 58979708
5-(2,4-dichlorophenyl)-2-propan-2-yl-1,3-oxazole (PubChem CID 58979708) has the molecular formula C12H11Cl2NO and a molecular weight of 256.13 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-propan-2-yl-1,3-oxazole.
| Compound Name | 5-(2,4-dichlorophenyl)-2-propan-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 58979708 |
| Molecular Formula | C12H11Cl2NO |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-propan-2-yl-1,3-oxazole |
| SMILES | CC(C)c1ncc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C12H11Cl2NO/c1-7(2)12-15-6-11(16-12)9-4-3-8(13)5-10(9)14/h3-7H,1-2H3 |
| InChIKey | BSTZFGWRXUPIQY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |