C11H8Cl3NO — CID 93258000
2-[(1S)-1-chloroethyl]-5-(2,4-dichlorophenyl)-1,3-oxazole (PubChem CID 93258000) has the molecular formula C11H8Cl3NO and a molecular weight of 276.55 g/mol. Its IUPAC name is 2-[(1S)-1-chloroethyl]-5-(2,4-dichlorophenyl)-1,3-oxazole.
| Compound Name | 2-[(1S)-1-chloroethyl]-5-(2,4-dichlorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 93258000 |
| Molecular Formula | C11H8Cl3NO |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | 2-[(1S)-1-chloroethyl]-5-(2,4-dichlorophenyl)-1,3-oxazole |
| SMILES | C[C@H](Cl)c1ncc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C11H8Cl3NO/c1-6(12)11-15-5-10(16-11)8-3-2-7(13)4-9(8)14/h2-6H,1H3/t6-/m0/s1 |
| InChIKey | IPLDDVLMUCMFHS-LURJTMIESA-N |
| XLogP | 4.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|