C12H11ClFNO2 — CID 102885537
2-(1-chloroethyl)-5-(2-fluoro-4-methoxyphenyl)-1,3-oxazole (PubChem CID 102885537) has the molecular formula C12H11ClFNO2 and a molecular weight of 255.68 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-(2-fluoro-4-methoxyphenyl)-1,3-oxazole.
| Compound Name | 2-(1-chloroethyl)-5-(2-fluoro-4-methoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 102885537 |
| Molecular Formula | C12H11ClFNO2 |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-(1-chloroethyl)-5-(2-fluoro-4-methoxyphenyl)-1,3-oxazole |
| SMILES | COc1ccc(-c2cnc(C(C)Cl)o2)c(F)c1 |
| InChI | InChI=1S/C12H11ClFNO2/c1-7(13)12-15-6-11(17-12)9-4-3-8(16-2)5-10(9)14/h3-7H,1-2H3 |
| InChIKey | LTPLPCYEWSYNOD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|