C12H13FN2O2 — CID 102885541
2-[5-(2-fluoro-4-methoxyphenyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 102885541) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-[5-(2-fluoro-4-methoxyphenyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 2-[5-(2-fluoro-4-methoxyphenyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 102885541 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[5-(2-fluoro-4-methoxyphenyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | COc1ccc(-c2cnc(CCN)o2)c(F)c1 |
| InChI | InChI=1S/C12H13FN2O2/c1-16-8-2-3-9(10(13)6-8)11-7-15-12(17-11)4-5-14/h2-3,6-7H,4-5,14H2,1H3 |
| InChIKey | JIDSCQRHIVYHBX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |