C11H11FN2O — CID 65178588
2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65178588) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 65178588 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | NCCc1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C11H11FN2O/c12-9-4-2-1-3-8(9)10-7-14-11(15-10)5-6-13/h1-4,7H,5-6,13H2 |
| InChIKey | OYXIMGGCQPGELF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |