C24H20FN3O2 — CID 16590817
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N',N'-diphenylpropanehydrazide (PubChem CID 16590817) has the molecular formula C24H20FN3O2 and a molecular weight of 401.44 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N',N'-diphenylpropanehydrazide.
| Compound Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N',N'-diphenylpropanehydrazide |
|---|---|
| PubChem CID | 16590817 |
| Molecular Formula | C24H20FN3O2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N',N'-diphenylpropanehydrazide |
| SMILES | O=C(CCc1ncc(-c2ccccc2F)o1)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20FN3O2/c25-21-14-8-7-13-20(21)22-17-26-24(30-22)16-15-23(29)27-28(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-14,17H,15-16H2,(H,27,29) |
| InChIKey | BGTXVNQTJIQBOG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|