C18H14FN3O4 — CID 16600080
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(4-nitrophenyl)propanamide (PubChem CID 16600080) has the molecular formula C18H14FN3O4 and a molecular weight of 355.33 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(4-nitrophenyl)propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 16600080 |
| Molecular Formula | C18H14FN3O4 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(4-nitrophenyl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2F)o1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H14FN3O4/c19-15-4-2-1-3-14(15)16-11-20-18(26-16)10-9-17(23)21-12-5-7-13(8-6-12)22(24)25/h1-8,11H,9-10H2,(H,21,23) |
| InChIKey | FIBBNZADTGFJAC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|