C22H21FN4O3 — CID 78866393
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-[4-(3-oxopiperazin-1-yl)phenyl]propanamide (PubChem CID 78866393) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-[4-(3-oxopiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-[4-(3-oxopiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 78866393 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-[4-(3-oxopiperazin-1-yl)phenyl]propanamide |
| SMILES | O=C1CN(c2ccc(NC(=O)CCc3ncc(-c4ccccc4F)o3)cc2)CCN1 |
| InChI | InChI=1S/C22H21FN4O3/c23-18-4-2-1-3-17(18)19-13-25-22(30-19)10-9-20(28)26-15-5-7-16(8-6-15)27-12-11-24-21(29)14-27/h1-8,13H,9-12,14H2,(H,24,29)(H,26,28) |
| InChIKey | TWLFBMPRMGGGIY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|