C19H25N5O3 — CID 86991458
3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[4-(3-oxopiperazin-1-yl)phenyl]propanamide (PubChem CID 86991458) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[4-(3-oxopiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[4-(3-oxopiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 86991458 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[4-(3-oxopiperazin-1-yl)phenyl]propanamide |
| SMILES | CC(C)(C)c1noc(CCC(=O)Nc2ccc(N3CCNC(=O)C3)cc2)n1 |
| InChI | InChI=1S/C19H25N5O3/c1-19(2,3)18-22-17(27-23-18)9-8-15(25)21-13-4-6-14(7-5-13)24-11-10-20-16(26)12-24/h4-7H,8-12H2,1-3H3,(H,20,26)(H,21,25) |
| InChIKey | QXRPXXOEFCPWKG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|