C16H18FN3O2 — CID 119451502
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyrrolidin-3-ylpropanamide (PubChem CID 119451502) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyrrolidin-3-ylpropanamide.
| Compound Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyrrolidin-3-ylpropanamide |
|---|---|
| PubChem CID | 119451502 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-pyrrolidin-3-ylpropanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2F)o1)NC1CCNC1 |
| InChI | InChI=1S/C16H18FN3O2/c17-13-4-2-1-3-12(13)14-10-19-16(22-14)6-5-15(21)20-11-7-8-18-9-11/h1-4,10-11,18H,5-9H2,(H,20,21) |
| InChIKey | RNQBWHZMUQIPSN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |