C18H22Cl2FN3O2 — CID 120656321
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propan-1-one;dihydrochloride (PubChem CID 120656321) has the molecular formula C18H22Cl2FN3O2 and a molecular weight of 402.30 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propan-1-one;dihydrochloride.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120656321 |
| Molecular Formula | C18H22Cl2FN3O2 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCc1ncc(-c2ccccc2F)o1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C18H20FN3O2.2ClH/c19-15-4-2-1-3-14(15)16-9-21-17(24-16)5-6-18(23)22-10-12-7-20-8-13(12)11-22;;/h1-4,9,12-13,20H,5-8,10-11H2;2*1H/t12-,13+;; |
| InChIKey | WXHYLRKGPIZBRK-FQDOXHKTSA-N |
| XLogP | 2.93 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |