C19H17FN2O3 — CID 18138235
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-4-methylphenyl)propanamide (PubChem CID 18138235) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-4-methylphenyl)propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 18138235 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCc2ncc(-c3ccccc3F)o2)c(O)c1 |
| InChI | InChI=1S/C19H17FN2O3/c1-12-6-7-15(16(23)10-12)22-18(24)8-9-19-21-11-17(25-19)13-4-2-3-5-14(13)20/h2-7,10-11,23H,8-9H2,1H3,(H,22,24) |
| InChIKey | QUHVPEFJOKBVNG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|