C21H21FN2O3 — CID 46538866
3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-propoxyphenyl)propanamide (PubChem CID 46538866) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-propoxyphenyl)propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-propoxyphenyl)propanamide |
|---|---|
| PubChem CID | 46538866 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-propoxyphenyl)propanamide |
| SMILES | CCCOc1ccccc1NC(=O)CCc1ncc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C21H21FN2O3/c1-2-13-26-18-10-6-5-9-17(18)24-20(25)11-12-21-23-14-19(27-21)15-7-3-4-8-16(15)22/h3-10,14H,2,11-13H2,1H3,(H,24,25) |
| InChIKey | RUKGDDDKZJMNLT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |