C19H15FN2O5 — CID 43063041
(4-nitrophenyl)methyl 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 43063041) has the molecular formula C19H15FN2O5 and a molecular weight of 370.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | (4-nitrophenyl)methyl 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 43063041 |
| Molecular Formula | C19H15FN2O5 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | O=C(CCc1ncc(-c2ccccc2F)o1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15FN2O5/c20-16-4-2-1-3-15(16)17-11-21-18(27-17)9-10-19(23)26-12-13-5-7-14(8-6-13)22(24)25/h1-8,11H,9-10,12H2 |
| InChIKey | SRRRCLBDOOUNQC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|