[2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid

C9H8Cl2NO3PS — CID 67726992

IUPAC[2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid
SMILESN#CC(CSP(=O)(O)O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C9H8Cl2NO3PS/c10-7-1-2-8(9(11)3-7)6(4-12)5-17-16(13,14)15/h1-3,6H,5H2,(H2,13,14,15)
InChIKeyAYOZQEXBTZVTEF-UHFFFAOYSA-N
MW312.11 g/mol
LogP3.43
Rot. Bonds4

About [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid

[2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid (PubChem CID 67726992) has the molecular formula C9H8Cl2NO3PS and a molecular weight of 312.11 g/mol. Its IUPAC name is [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid.

Molecular Properties

Compound Name[2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid
PubChem CID67726992
Molecular FormulaC9H8Cl2NO3PS
Molecular Weight312.11 g/mol
Exact Mass310.93
IUPAC Name[2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid
SMILESN#CC(CSP(=O)(O)O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C9H8Cl2NO3PS/c10-7-1-2-8(9(11)3-7)6(4-12)5-17-16(13,14)15/h1-3,6H,5H2,(H2,13,14,15)
InChIKeyAYOZQEXBTZVTEF-UHFFFAOYSA-N
XLogP3.43
TPSA81.32 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.11
LogP ≤ 53.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid?
The IUPAC name of [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid (CID 67726992) is [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid.
What is the SMILES notation for [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid?
The canonical SMILES for [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid is N#CC(CSP(=O)(O)O)c1ccc(Cl)cc1Cl.
What is the InChIKey of [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid?
The InChIKey is AYOZQEXBTZVTEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2NO3PS/c10-7-1-2-8(9(11)3-7)6(4-12)5-17-16(13,14)15/h1-3,6H,5H2,(H2,13,14,15).
What are the key properties of [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid?
[2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid has a molecular weight of 312.11 g/mol, XLogP of 3.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid is sourced from PubChem (CID 67726992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).