C9H8Cl2NO3PS — CID 67726992
[2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid (PubChem CID 67726992) has the molecular formula C9H8Cl2NO3PS and a molecular weight of 312.11 g/mol. Its IUPAC name is [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid.
| Compound Name | [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid |
|---|---|
| PubChem CID | 67726992 |
| Molecular Formula | C9H8Cl2NO3PS |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 310.93 |
| IUPAC Name | [2-cyano-2-(2,4-dichlorophenyl)ethyl]sulfanylphosphonic acid |
| SMILES | N#CC(CSP(=O)(O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2NO3PS/c10-7-1-2-8(9(11)3-7)6(4-12)5-17-16(13,14)15/h1-3,6H,5H2,(H2,13,14,15) |
| InChIKey | AYOZQEXBTZVTEF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|