C43H25F10IO6S4 — CID 173196146
[4-[4-(2-iodo-5-methylphenyl)phenyl]sulfanylphenyl]-diphenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate;2,3,4,5,6-pentafluorobenzenesulfonic acid (PubChem CID 173196146) has the molecular formula C43H25F10IO6S4 and a molecular weight of 1082.82 g/mol. Its IUPAC name is [4-[4-(2-iodo-5-methylphenyl)phenyl]sulfanylphenyl]-diphenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate;2,3,4,5,6-pentafluorobenzenesulfonic acid.
| Compound Name | [4-[4-(2-iodo-5-methylphenyl)phenyl]sulfanylphenyl]-diphenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate;2,3,4,5,6-pentafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 173196146 |
| Molecular Formula | C43H25F10IO6S4 |
| Molecular Weight | 1082.82 g/mol |
| Exact Mass | 1081.94 |
| IUPAC Name | [4-[4-(2-iodo-5-methylphenyl)phenyl]sulfanylphenyl]-diphenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate;2,3,4,5,6-pentafluorobenzenesulfonic acid |
| SMILES | Cc1ccc(I)c(-c2ccc(Sc3ccc([S+](c4ccccc4)c4ccccc4)cc3)cc2)c1.O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F.O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C31H24IS2.2C6HF5O3S/c1-23-12-21-31(32)30(22-23)24-13-15-25(16-14-24)33-26-17-19-29(20-18-26)34(27-8-4-2-5-9-27)28-10-6-3-7-11-28;2*7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h2-22H,1H3;2*(H,12,13,14)/q+1;;/p-1 |
| InChIKey | HKSWRKGOFTUIFO-UHFFFAOYSA-M |
| XLogP | 12.43 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.82 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|