C55H52O6S5 — CID 172839906
4-methylbenzenesulfonate;tris[4-(4-acetyl-3-ethylphenyl)sulfanylphenyl]sulfanium (PubChem CID 172839906) has the molecular formula C55H52O6S5 and a molecular weight of 969.35 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;tris[4-(4-acetyl-3-ethylphenyl)sulfanylphenyl]sulfanium.
| Compound Name | 4-methylbenzenesulfonate;tris[4-(4-acetyl-3-ethylphenyl)sulfanylphenyl]sulfanium |
|---|---|
| PubChem CID | 172839906 |
| Molecular Formula | C55H52O6S5 |
| Molecular Weight | 969.35 g/mol |
| Exact Mass | 968.24 |
| IUPAC Name | 4-methylbenzenesulfonate;tris[4-(4-acetyl-3-ethylphenyl)sulfanylphenyl]sulfanium |
| SMILES | CCc1cc(Sc2ccc([S+](c3ccc(Sc4ccc(C(C)=O)c(CC)c4)cc3)c3ccc(Sc4ccc(C(C)=O)c(CC)c4)cc3)cc2)ccc1C(C)=O.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C48H45O3S4.C7H8O3S/c1-7-34-28-40(16-25-46(34)31(4)49)52-37-10-19-43(20-11-37)55(44-21-12-38(13-22-44)53-41-17-26-47(32(5)50)35(8-2)29-41)45-23-14-39(15-24-45)54-42-18-27-48(33(6)51)36(9-3)30-42;1-6-2-4-7(5-3-6)11(8,9)10/h10-30H,7-9H2,1-6H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | WQQJKWWDTBGMBR-UHFFFAOYSA-M |
| XLogP | 14.43 |
| TPSA | 108.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.35 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|