About diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate
diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate (PubChem CID 87706296) has the molecular formula C30H23Cl2IO9S
and a molecular weight of 757.38 g/mol. Its IUPAC name is diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate.
Molecular Properties
| Compound Name | diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate |
| PubChem CID | 87706296 |
| Molecular Formula | C30H23Cl2IO9S |
| Molecular Weight | 757.38 g/mol |
| Exact Mass | 755.95 |
| IUPAC Name | diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].c1ccc([I+]c2ccc(Oc3ccc([S+](c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H23IOS.2ClHO4/c1-4-10-24(11-5-1)31-25-16-18-26(19-17-25)32-27-20-22-30(23-21-27)33(28-12-6-2-7-13-28)29-14-8-3-9-15-29;2*2-1(3,4)5/h1-23H;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | WIJODHZCUUVVBW-UHFFFAOYSA-L |
| XLogP | -4.81 |
| TPSA | 193.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 757.38 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate?
The IUPAC name of diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate (CID 87706296) is diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate.
What is the SMILES notation for diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate?
The canonical SMILES for diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate is [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].c1ccc([I+]c2ccc(Oc3ccc([S+](c4ccccc4)c4ccccc4)cc3)cc2)cc1.
What is the InChIKey of diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate?
The InChIKey is WIJODHZCUUVVBW-UHFFFAOYSA-L. The full InChI is InChI=1S/C30H23IOS.2ClHO4/c1-4-10-24(11-5-1)31-25-16-18-26(19-17-25)32-27-20-22-30(23-21-27)33(28-12-6-2-7-13-28)29-14-8-3-9-15-29;2*2-1(3,4)5/h1-23H;2*(H,2,3,4,5)/q+2;;/p-2.
What are the key properties of diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate?
diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate has a molecular weight of 757.38 g/mol, XLogP of -4.81, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[4-(4-phenyliodoniophenoxy)phenyl]sulfanium diperchlorate is sourced from PubChem (CID 87706296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).