C13H20F3NO3S — CID 175841862
N,N-diethylethanamine;2-(trifluoromethyl)benzenesulfonic acid (PubChem CID 175841862) has the molecular formula C13H20F3NO3S and a molecular weight of 327.37 g/mol. Its IUPAC name is N,N-diethylethanamine;2-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | N,N-diethylethanamine;2-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 175841862 |
| Molecular Formula | C13H20F3NO3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N,N-diethylethanamine;2-(trifluoromethyl)benzenesulfonic acid |
| SMILES | CCN(CC)CC.O=S(=O)(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C7H5F3O3S.C6H15N/c8-7(9,10)5-3-1-2-4-6(5)14(11,12)13;1-4-7(5-2)6-3/h1-4H,(H,11,12,13);4-6H2,1-3H3 |
| InChIKey | JYCZHMFLXDNXDA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|