C19H12F3IO3S — CID 173082644
1-iodobiphenylene;2-(trifluoromethyl)benzenesulfonic acid (PubChem CID 173082644) has the molecular formula C19H12F3IO3S and a molecular weight of 504.27 g/mol. Its IUPAC name is 1-iodobiphenylene;2-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 1-iodobiphenylene;2-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 173082644 |
| Molecular Formula | C19H12F3IO3S |
| Molecular Weight | 504.27 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | 1-iodobiphenylene;2-(trifluoromethyl)benzenesulfonic acid |
| SMILES | Ic1cccc2c1-c1ccccc1-2.O=S(=O)(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H7I.C7H5F3O3S/c13-11-7-3-6-10-8-4-1-2-5-9(8)12(10)11;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h1-7H;1-4H,(H,11,12,13) |
| InChIKey | UHBUUEXYLRVDFU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.27 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|