C13H9F2NO4S — CID 32937499
(2-carbamoylphenyl) 2,6-difluorobenzenesulfonate (PubChem CID 32937499) has the molecular formula C13H9F2NO4S and a molecular weight of 313.28 g/mol. Its IUPAC name is (2-carbamoylphenyl) 2,6-difluorobenzenesulfonate.
| Compound Name | (2-carbamoylphenyl) 2,6-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 32937499 |
| Molecular Formula | C13H9F2NO4S |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | (2-carbamoylphenyl) 2,6-difluorobenzenesulfonate |
| SMILES | NC(=O)c1ccccc1OS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H9F2NO4S/c14-9-5-3-6-10(15)12(9)21(18,19)20-11-7-2-1-4-8(11)13(16)17/h1-7H,(H2,16,17) |
| InChIKey | XMNWCXCLLQUHTJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|