About (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate
(4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate (PubChem CID 30327715) has the molecular formula C15H13BrO5S
and a molecular weight of 385.24 g/mol. Its IUPAC name is (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate.
Molecular Properties
| Compound Name | (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate |
| PubChem CID | 30327715 |
| Molecular Formula | C15H13BrO5S |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate |
| SMILES | COc1cc(C(C)=O)ccc1OS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H13BrO5S/c1-10(17)11-6-7-14(15(8-11)20-2)21-22(18,19)13-5-3-4-12(16)9-13/h3-9H,1-2H3 |
| InChIKey | MQRJBMBGDLDNMS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate?
The IUPAC name of (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate (CID 30327715) is (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate.
What is the SMILES notation for (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate?
The canonical SMILES for (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate is COc1cc(C(C)=O)ccc1OS(=O)(=O)c1cccc(Br)c1.
What is the InChIKey of (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate?
The InChIKey is MQRJBMBGDLDNMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrO5S/c1-10(17)11-6-7-14(15(8-11)20-2)21-22(18,19)13-5-3-4-12(16)9-13/h3-9H,1-2H3.
What are the key properties of (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate?
(4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate has a molecular weight of 385.24 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyl-2-methoxyphenyl) 3-bromobenzenesulfonate is sourced from PubChem (CID 30327715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).