C25H22O7S — CID 58318358
2-[2-[3-(benzenesulfonyloxy)-4-methoxyphenyl]-2-oxoethyl]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 58318358) has the molecular formula C25H22O7S and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-[2-[3-(benzenesulfonyloxy)-4-methoxyphenyl]-2-oxoethyl]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[2-[3-(benzenesulfonyloxy)-4-methoxyphenyl]-2-oxoethyl]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 58318358 |
| Molecular Formula | C25H22O7S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2-[2-[3-(benzenesulfonyloxy)-4-methoxyphenyl]-2-oxoethyl]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | COc1ccc(C(=O)CC2(C(=O)O)Cc3ccccc3C2)cc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22O7S/c1-31-22-12-11-17(13-23(22)32-33(29,30)20-9-3-2-4-10-20)21(26)16-25(24(27)28)14-18-7-5-6-8-19(18)15-25/h2-13H,14-16H2,1H3,(H,27,28) |
| InChIKey | VHXTUCGRTLDXPO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|