C18H24O5 — CID 146004384
2-[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 146004384) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 146004384 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | COc1ccc(C(=O)CC2(CC(=O)O)CCCCC2)cc1OC |
| InChI | InChI=1S/C18H24O5/c1-22-15-7-6-13(10-16(15)23-2)14(19)11-18(12-17(20)21)8-4-3-5-9-18/h6-7,10H,3-5,8-9,11-12H2,1-2H3,(H,20,21) |
| InChIKey | QIADWKDMUXVDSK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |