C15H18O5 — CID 118579996
1-[2-(3-hydroxy-4-methoxyphenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 118579996) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 1-[2-(3-hydroxy-4-methoxyphenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-(3-hydroxy-4-methoxyphenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 118579996 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-[2-(3-hydroxy-4-methoxyphenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | COc1ccc(C(=O)CC2(C(=O)O)CCCC2)cc1O |
| InChI | InChI=1S/C15H18O5/c1-20-13-5-4-10(8-11(13)16)12(17)9-15(14(18)19)6-2-3-7-15/h4-5,8,16H,2-3,6-7,9H2,1H3,(H,18,19) |
| InChIKey | RBNDLWGDMGSZJU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |