C19H26O4 — CID 146004249
2-[1-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-oxoethyl]cyclopentyl]acetic acid (PubChem CID 146004249) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-[1-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-oxoethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-oxoethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 146004249 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-[1-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-oxoethyl]cyclopentyl]acetic acid |
| SMILES | CC(C)(C)Oc1ccc(C(=O)CC2(CC(=O)O)CCCC2)cc1 |
| InChI | InChI=1S/C19H26O4/c1-18(2,3)23-15-8-6-14(7-9-15)16(20)12-19(13-17(21)22)10-4-5-11-19/h6-9H,4-5,10-13H2,1-3H3,(H,21,22) |
| InChIKey | QYXWEMFGXZWOND-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |