C16H19FO3 — CID 146004495
2-[1-[2-(3-fluorophenyl)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 146004495) has the molecular formula C16H19FO3 and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-[1-[2-(3-fluorophenyl)-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(3-fluorophenyl)-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 146004495 |
| Molecular Formula | C16H19FO3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[1-[2-(3-fluorophenyl)-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)c2cccc(F)c2)CCCCC1 |
| InChI | InChI=1S/C16H19FO3/c17-13-6-4-5-12(9-13)14(18)10-16(11-15(19)20)7-2-1-3-8-16/h4-6,9H,1-3,7-8,10-11H2,(H,19,20) |
| InChIKey | QVVFUCRBVHZOSP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |