C15H17FO3S — CID 107777661
methyl 2-[1-[[2-(3-fluorophenyl)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777661) has the molecular formula C15H17FO3S and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl 2-[1-[[2-(3-fluorophenyl)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[2-(3-fluorophenyl)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777661 |
| Molecular Formula | C15H17FO3S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | methyl 2-[1-[[2-(3-fluorophenyl)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCC(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H17FO3S/c1-19-14(18)8-15(5-6-15)10-20-9-13(17)11-3-2-4-12(16)7-11/h2-4,7H,5-6,8-10H2,1H3 |
| InChIKey | XZHXVYPQWRPGMC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |