C12H13FO3 — CID 65497401
2-[1-[(3-fluorophenoxy)methyl]cyclopropyl]acetic acid (PubChem CID 65497401) has the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. Its IUPAC name is 2-[1-[(3-fluorophenoxy)methyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(3-fluorophenoxy)methyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65497401 |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-[1-[(3-fluorophenoxy)methyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(COc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C12H13FO3/c13-9-2-1-3-10(6-9)16-8-12(4-5-12)7-11(14)15/h1-3,6H,4-5,7-8H2,(H,14,15) |
| InChIKey | ULTIWCHTWBYEHN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |