C17H21ClO3 — CID 146004327
2-[1-[2-(4-chloro-3-methylphenyl)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 146004327) has the molecular formula C17H21ClO3 and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-[1-[2-(4-chloro-3-methylphenyl)-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(4-chloro-3-methylphenyl)-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 146004327 |
| Molecular Formula | C17H21ClO3 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[1-[2-(4-chloro-3-methylphenyl)-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | Cc1cc(C(=O)CC2(CC(=O)O)CCCCC2)ccc1Cl |
| InChI | InChI=1S/C17H21ClO3/c1-12-9-13(5-6-14(12)18)15(19)10-17(11-16(20)21)7-3-2-4-8-17/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,20,21) |
| InChIKey | YGYOPMRRELUYMK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |