C14H12ClNO7S — CID 18086401
(2-chloro-4-nitrophenyl) 3,4-dimethoxybenzenesulfonate (PubChem CID 18086401) has the molecular formula C14H12ClNO7S and a molecular weight of 373.77 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) 3,4-dimethoxybenzenesulfonate.
| Compound Name | (2-chloro-4-nitrophenyl) 3,4-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 18086401 |
| Molecular Formula | C14H12ClNO7S |
| Molecular Weight | 373.77 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | (2-chloro-4-nitrophenyl) 3,4-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2Cl)cc1OC |
| InChI | InChI=1S/C14H12ClNO7S/c1-21-13-6-4-10(8-14(13)22-2)24(19,20)23-12-5-3-9(16(17)18)7-11(12)15/h3-8H,1-2H3 |
| InChIKey | AHWFMBBAMMPAIK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|