C16H17ClO5S — CID 32938200
(4-chloro-3-ethylphenyl) 3,4-dimethoxybenzenesulfonate (PubChem CID 32938200) has the molecular formula C16H17ClO5S and a molecular weight of 356.83 g/mol. Its IUPAC name is (4-chloro-3-ethylphenyl) 3,4-dimethoxybenzenesulfonate.
| Compound Name | (4-chloro-3-ethylphenyl) 3,4-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 32938200 |
| Molecular Formula | C16H17ClO5S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (4-chloro-3-ethylphenyl) 3,4-dimethoxybenzenesulfonate |
| SMILES | CCc1cc(OS(=O)(=O)c2ccc(OC)c(OC)c2)ccc1Cl |
| InChI | InChI=1S/C16H17ClO5S/c1-4-11-9-12(5-7-14(11)17)22-23(18,19)13-6-8-15(20-2)16(10-13)21-3/h5-10H,4H2,1-3H3 |
| InChIKey | RRARSSQNBKYVIL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|