C13H9Cl3O4S — CID 2192067
(2,5-dichlorophenyl) 4-chloro-3-methoxybenzenesulfonate (PubChem CID 2192067) has the molecular formula C13H9Cl3O4S and a molecular weight of 367.64 g/mol. Its IUPAC name is (2,5-dichlorophenyl) 4-chloro-3-methoxybenzenesulfonate.
| Compound Name | (2,5-dichlorophenyl) 4-chloro-3-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 2192067 |
| Molecular Formula | C13H9Cl3O4S |
| Molecular Weight | 367.64 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | (2,5-dichlorophenyl) 4-chloro-3-methoxybenzenesulfonate |
| SMILES | COc1cc(S(=O)(=O)Oc2cc(Cl)ccc2Cl)ccc1Cl |
| InChI | InChI=1S/C13H9Cl3O4S/c1-19-12-7-9(3-5-10(12)15)21(17,18)20-13-6-8(14)2-4-11(13)16/h2-7H,1H3 |
| InChIKey | RFTCULSJHRUBCM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|