C17H17ClN2O7S — CID 71844740
(2-chloro-4-nitrophenyl) 4-methoxy-3-[(propanoylamino)methyl]benzenesulfonate (PubChem CID 71844740) has the molecular formula C17H17ClN2O7S and a molecular weight of 428.85 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) 4-methoxy-3-[(propanoylamino)methyl]benzenesulfonate.
| Compound Name | (2-chloro-4-nitrophenyl) 4-methoxy-3-[(propanoylamino)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 71844740 |
| Molecular Formula | C17H17ClN2O7S |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | (2-chloro-4-nitrophenyl) 4-methoxy-3-[(propanoylamino)methyl]benzenesulfonate |
| SMILES | CCC(=O)NCc1cc(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2Cl)ccc1OC |
| InChI | InChI=1S/C17H17ClN2O7S/c1-3-17(21)19-10-11-8-13(5-7-15(11)26-2)28(24,25)27-16-6-4-12(20(22)23)9-14(16)18/h4-9H,3,10H2,1-2H3,(H,19,21) |
| InChIKey | SPYZAZBUJOOBPN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|