C22H19IO6S — CID 10918548
[2-[2-(2-iodo-4,5-dimethoxyphenyl)-2-oxoethyl]phenyl] benzenesulfonate (PubChem CID 10918548) has the molecular formula C22H19IO6S and a molecular weight of 538.36 g/mol. Its IUPAC name is [2-[2-(2-iodo-4,5-dimethoxyphenyl)-2-oxoethyl]phenyl] benzenesulfonate.
| Compound Name | [2-[2-(2-iodo-4,5-dimethoxyphenyl)-2-oxoethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 10918548 |
| Molecular Formula | C22H19IO6S |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 537.99 |
| IUPAC Name | [2-[2-(2-iodo-4,5-dimethoxyphenyl)-2-oxoethyl]phenyl] benzenesulfonate |
| SMILES | COc1cc(I)c(C(=O)Cc2ccccc2OS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H19IO6S/c1-27-21-13-17(18(23)14-22(21)28-2)19(24)12-15-8-6-7-11-20(15)29-30(25,26)16-9-4-3-5-10-16/h3-11,13-14H,12H2,1-2H3 |
| InChIKey | VUYAEMRNUZJZHF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|