C15H13N3O8S — CID 18363996
methyl 2-[2-(2,4-dinitrophenyl)sulfonylanilino]acetate (PubChem CID 18363996) has the molecular formula C15H13N3O8S and a molecular weight of 395.35 g/mol. Its IUPAC name is methyl 2-[2-(2,4-dinitrophenyl)sulfonylanilino]acetate.
| Compound Name | methyl 2-[2-(2,4-dinitrophenyl)sulfonylanilino]acetate |
|---|---|
| PubChem CID | 18363996 |
| Molecular Formula | C15H13N3O8S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | methyl 2-[2-(2,4-dinitrophenyl)sulfonylanilino]acetate |
| SMILES | COC(=O)CNc1ccccc1S(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O8S/c1-26-15(19)9-16-11-4-2-3-5-13(11)27(24,25)14-7-6-10(17(20)21)8-12(14)18(22)23/h2-8,16H,9H2,1H3 |
| InChIKey | ARLZVFDRBGPEEH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|