C22H19N3O7S — CID 22303709
methyl 2-[[2-[2-(2-nitrophenyl)sulfonylanilino]acetyl]amino]benzoate (PubChem CID 22303709) has the molecular formula C22H19N3O7S and a molecular weight of 469.48 g/mol. Its IUPAC name is methyl 2-[[2-[2-(2-nitrophenyl)sulfonylanilino]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[2-(2-nitrophenyl)sulfonylanilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 22303709 |
| Molecular Formula | C22H19N3O7S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | methyl 2-[[2-[2-(2-nitrophenyl)sulfonylanilino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CNc1ccccc1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O7S/c1-32-22(27)15-8-2-3-9-16(15)24-21(26)14-23-17-10-4-6-12-19(17)33(30,31)20-13-7-5-11-18(20)25(28)29/h2-13,23H,14H2,1H3,(H,24,26) |
| InChIKey | FHDIAJDBVZFTFD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|