C10H12N2O4S — CID 86123043
(4-nitrophenyl) N-(2-methylsulfanylethyl)carbamate (PubChem CID 86123043) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is (4-nitrophenyl) N-(2-methylsulfanylethyl)carbamate.
| Compound Name | (4-nitrophenyl) N-(2-methylsulfanylethyl)carbamate |
|---|---|
| PubChem CID | 86123043 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (4-nitrophenyl) N-(2-methylsulfanylethyl)carbamate |
| SMILES | CSCCNC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H12N2O4S/c1-17-7-6-11-10(13)16-9-4-2-8(3-5-9)12(14)15/h2-5H,6-7H2,1H3,(H,11,13) |
| InChIKey | BVVFOXAFNRPEFH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|