C24H30N4O6S — CID 59909568
(4-nitrophenyl) N-[1-[[(2S)-3-methyl-1-(2-methylsulfanylethylamino)-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 59909568) has the molecular formula C24H30N4O6S and a molecular weight of 502.59 g/mol. Its IUPAC name is (4-nitrophenyl) N-[1-[[(2S)-3-methyl-1-(2-methylsulfanylethylamino)-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | (4-nitrophenyl) N-[1-[[(2S)-3-methyl-1-(2-methylsulfanylethylamino)-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 59909568 |
| Molecular Formula | C24H30N4O6S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (4-nitrophenyl) N-[1-[[(2S)-3-methyl-1-(2-methylsulfanylethylamino)-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CSCCNC(=O)[C@@H](NC(=O)C(Cc1ccccc1)NC(=O)Oc1ccc([N+](=O)[O-])cc1)C(C)C |
| InChI | InChI=1S/C24H30N4O6S/c1-16(2)21(23(30)25-13-14-35-3)27-22(29)20(15-17-7-5-4-6-8-17)26-24(31)34-19-11-9-18(10-12-19)28(32)33/h4-12,16,20-21H,13-15H2,1-3H3,(H,25,30)(H,26,31)(H,27,29)/t20?,21-/m0/s1 |
| InChIKey | MWOVDKFVYUMFCP-LBAQZLPGSA-N |
| XLogP | 2.91 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|