C15H14N2O4S — CID 579779
(4-nitrophenyl) N-(2-phenylsulfanylethyl)carbamate (PubChem CID 579779) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is (4-nitrophenyl) N-(2-phenylsulfanylethyl)carbamate.
| Compound Name | (4-nitrophenyl) N-(2-phenylsulfanylethyl)carbamate |
|---|---|
| PubChem CID | 579779 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (4-nitrophenyl) N-(2-phenylsulfanylethyl)carbamate |
| SMILES | O=C(NCCSc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H14N2O4S/c18-15(16-10-11-22-14-4-2-1-3-5-14)21-13-8-6-12(7-9-13)17(19)20/h1-9H,10-11H2,(H,16,18) |
| InChIKey | YGYMADBZTVASSE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|